C15H14Cl2N2O2 — CID 63121176
N-[3-(2-aminoethoxy)phenyl]-2,5-dichlorobenzamide (PubChem CID 63121176) has the molecular formula C15H14Cl2N2O2 and a molecular weight of 325.20 g/mol. Its IUPAC name is N-[3-(2-aminoethoxy)phenyl]-2,5-dichlorobenzamide.
| Compound Name | N-[3-(2-aminoethoxy)phenyl]-2,5-dichlorobenzamide |
|---|---|
| PubChem CID | 63121176 |
| Molecular Formula | C15H14Cl2N2O2 |
| Molecular Weight | 325.20 g/mol |
| Exact Mass | 324.04 |
| IUPAC Name | N-[3-(2-aminoethoxy)phenyl]-2,5-dichlorobenzamide |
| SMILES | NCCOc1cccc(NC(=O)c2cc(Cl)ccc2Cl)c1 |
| InChI | InChI=1S/C15H14Cl2N2O2/c16-10-4-5-14(17)13(8-10)15(20)19-11-2-1-3-12(9-11)21-7-6-18/h1-5,8-9H,6-7,18H2,(H,19,20) |
| InChIKey | WSQPCZRAKMPEFK-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.20 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |