C17H15ClN2O4 — CID 888716
5-chloro-2-[[4-(propanoylamino)benzoyl]amino]benzoic acid (PubChem CID 888716) has the molecular formula C17H15ClN2O4 and a molecular weight of 346.77 g/mol. Its IUPAC name is 5-chloro-2-[[4-(propanoylamino)benzoyl]amino]benzoic acid.
| Compound Name | 5-chloro-2-[[4-(propanoylamino)benzoyl]amino]benzoic acid |
|---|---|
| PubChem CID | 888716 |
| Molecular Formula | C17H15ClN2O4 |
| Molecular Weight | 346.77 g/mol |
| Exact Mass | 346.07 |
| IUPAC Name | 5-chloro-2-[[4-(propanoylamino)benzoyl]amino]benzoic acid |
| SMILES | CCC(=O)Nc1ccc(C(=O)Nc2ccc(Cl)cc2C(=O)O)cc1 |
| InChI | InChI=1S/C17H15ClN2O4/c1-2-15(21)19-12-6-3-10(4-7-12)16(22)20-14-8-5-11(18)9-13(14)17(23)24/h3-9H,2H2,1H3,(H,19,21)(H,20,22)(H,23,24) |
| InChIKey | PWWDTHYIUJCJBQ-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.77 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |