C21H20N6O2S — CID 24672221
2-cyclopropyl-4,5-dimethyl-N'-(2-methylimidazo[1,2-a]pyridine-3-carbonyl)thieno[2,3-d]pyrimidine-6-carbohydrazide (PubChem CID 24672221) has the molecular formula C21H20N6O2S and a molecular weight of 420.50 g/mol. Its IUPAC name is 2-cyclopropyl-4,5-dimethyl-N'-(2-methylimidazo[1,2-a]pyridine-3-carbonyl)thieno[2,3-d]pyrimidine-6-carbohydrazide.
| Compound Name | 2-cyclopropyl-4,5-dimethyl-N'-(2-methylimidazo[1,2-a]pyridine-3-carbonyl)thieno[2,3-d]pyrimidine-6-carbohydrazide |
|---|---|
| PubChem CID | 24672221 |
| Molecular Formula | C21H20N6O2S |
| Molecular Weight | 420.50 g/mol |
| Exact Mass | 420.14 |
| IUPAC Name | 2-cyclopropyl-4,5-dimethyl-N'-(2-methylimidazo[1,2-a]pyridine-3-carbonyl)thieno[2,3-d]pyrimidine-6-carbohydrazide |
| SMILES | Cc1nc2ccccn2c1C(=O)NNC(=O)c1sc2nc(C3CC3)nc(C)c2c1C |
| InChI | InChI=1S/C21H20N6O2S/c1-10-15-11(2)23-18(13-7-8-13)24-21(15)30-17(10)20(29)26-25-19(28)16-12(3)22-14-6-4-5-9-27(14)16/h4-6,9,13H,7-8H2,1-3H3,(H,25,28)(H,26,29) |
| InChIKey | MFPAAHOSQAVPIS-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 101.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.50 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|