C17H20N4O3S — CID 39480750
2-cyclopropyl-4,5-dimethyl-N'-[(2S)-oxolane-2-carbonyl]thieno[2,3-d]pyrimidine-6-carbohydrazide (PubChem CID 39480750) has the molecular formula C17H20N4O3S and a molecular weight of 360.44 g/mol. Its IUPAC name is 2-cyclopropyl-4,5-dimethyl-N'-[(2S)-oxolane-2-carbonyl]thieno[2,3-d]pyrimidine-6-carbohydrazide.
| Compound Name | 2-cyclopropyl-4,5-dimethyl-N'-[(2S)-oxolane-2-carbonyl]thieno[2,3-d]pyrimidine-6-carbohydrazide |
|---|---|
| PubChem CID | 39480750 |
| Molecular Formula | C17H20N4O3S |
| Molecular Weight | 360.44 g/mol |
| Exact Mass | 360.13 |
| IUPAC Name | 2-cyclopropyl-4,5-dimethyl-N'-[(2S)-oxolane-2-carbonyl]thieno[2,3-d]pyrimidine-6-carbohydrazide |
| SMILES | Cc1nc(C2CC2)nc2sc(C(=O)NNC(=O)[C@@H]3CCCO3)c(C)c12 |
| InChI | InChI=1S/C17H20N4O3S/c1-8-12-9(2)18-14(10-5-6-10)19-17(12)25-13(8)16(23)21-20-15(22)11-4-3-7-24-11/h10-11H,3-7H2,1-2H3,(H,20,22)(H,21,23)/t11-/m0/s1 |
| InChIKey | FUSCVNFCWBUMJG-NSHDSACASA-N |
| XLogP | 2.13 |
| TPSA | 93.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.44 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|