C21H19N5O2S — CID 24666705
2-cyclopropyl-N'-(1H-indole-3-carbonyl)-4,5-dimethylthieno[2,3-d]pyrimidine-6-carbohydrazide (PubChem CID 24666705) has the molecular formula C21H19N5O2S and a molecular weight of 405.48 g/mol. Its IUPAC name is 2-cyclopropyl-N'-(1H-indole-3-carbonyl)-4,5-dimethylthieno[2,3-d]pyrimidine-6-carbohydrazide.
| Compound Name | 2-cyclopropyl-N'-(1H-indole-3-carbonyl)-4,5-dimethylthieno[2,3-d]pyrimidine-6-carbohydrazide |
|---|---|
| PubChem CID | 24666705 |
| Molecular Formula | C21H19N5O2S |
| Molecular Weight | 405.48 g/mol |
| Exact Mass | 405.13 |
| IUPAC Name | 2-cyclopropyl-N'-(1H-indole-3-carbonyl)-4,5-dimethylthieno[2,3-d]pyrimidine-6-carbohydrazide |
| SMILES | Cc1nc(C2CC2)nc2sc(C(=O)NNC(=O)c3c[nH]c4ccccc34)c(C)c12 |
| InChI | InChI=1S/C21H19N5O2S/c1-10-16-11(2)23-18(12-7-8-12)24-21(16)29-17(10)20(28)26-25-19(27)14-9-22-15-6-4-3-5-13(14)15/h3-6,9,12,22H,7-8H2,1-2H3,(H,25,27)(H,26,28) |
| InChIKey | OYQYQKPAIBAAOY-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 99.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.48 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|