C20H15ClN4O2S — CID 24513912
2-(4-chlorophenyl)-N'-(1H-indole-3-carbonyl)-4-methyl-1,3-thiazole-5-carbohydrazide (PubChem CID 24513912) has the molecular formula C20H15ClN4O2S and a molecular weight of 410.89 g/mol. Its IUPAC name is 2-(4-chlorophenyl)-N'-(1H-indole-3-carbonyl)-4-methyl-1,3-thiazole-5-carbohydrazide.
| Compound Name | 2-(4-chlorophenyl)-N'-(1H-indole-3-carbonyl)-4-methyl-1,3-thiazole-5-carbohydrazide |
|---|---|
| PubChem CID | 24513912 |
| Molecular Formula | C20H15ClN4O2S |
| Molecular Weight | 410.89 g/mol |
| Exact Mass | 410.06 |
| IUPAC Name | 2-(4-chlorophenyl)-N'-(1H-indole-3-carbonyl)-4-methyl-1,3-thiazole-5-carbohydrazide |
| SMILES | Cc1nc(-c2ccc(Cl)cc2)sc1C(=O)NNC(=O)c1c[nH]c2ccccc12 |
| InChI | InChI=1S/C20H15ClN4O2S/c1-11-17(28-20(23-11)12-6-8-13(21)9-7-12)19(27)25-24-18(26)15-10-22-16-5-3-2-4-14(15)16/h2-10,22H,1H3,(H,24,26)(H,25,27) |
| InChIKey | MKVADUVQSSEOAM-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 86.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.89 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|