C21H17ClN4O3S — CID 134061924
2-[(4-chlorophenoxy)methyl]-N'-(1H-indole-3-carbonyl)-4-methyl-1,3-thiazole-5-carbohydrazide (PubChem CID 134061924) has the molecular formula C21H17ClN4O3S and a molecular weight of 440.91 g/mol. Its IUPAC name is 2-[(4-chlorophenoxy)methyl]-N'-(1H-indole-3-carbonyl)-4-methyl-1,3-thiazole-5-carbohydrazide.
| Compound Name | 2-[(4-chlorophenoxy)methyl]-N'-(1H-indole-3-carbonyl)-4-methyl-1,3-thiazole-5-carbohydrazide |
|---|---|
| PubChem CID | 134061924 |
| Molecular Formula | C21H17ClN4O3S |
| Molecular Weight | 440.91 g/mol |
| Exact Mass | 440.07 |
| IUPAC Name | 2-[(4-chlorophenoxy)methyl]-N'-(1H-indole-3-carbonyl)-4-methyl-1,3-thiazole-5-carbohydrazide |
| SMILES | Cc1nc(COc2ccc(Cl)cc2)sc1C(=O)NNC(=O)c1c[nH]c2ccccc12 |
| InChI | InChI=1S/C21H17ClN4O3S/c1-12-19(30-18(24-12)11-29-14-8-6-13(22)7-9-14)21(28)26-25-20(27)16-10-23-17-5-3-2-4-15(16)17/h2-10,23H,11H2,1H3,(H,25,27)(H,26,28) |
| InChIKey | ZCUVSUSOYDPAQK-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 96.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.91 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|