C22H20N4O2S — CID 24513901
2-(4-ethylphenyl)-N'-(1H-indole-3-carbonyl)-4-methyl-1,3-thiazole-5-carbohydrazide (PubChem CID 24513901) has the molecular formula C22H20N4O2S and a molecular weight of 404.50 g/mol. Its IUPAC name is 2-(4-ethylphenyl)-N'-(1H-indole-3-carbonyl)-4-methyl-1,3-thiazole-5-carbohydrazide.
| Compound Name | 2-(4-ethylphenyl)-N'-(1H-indole-3-carbonyl)-4-methyl-1,3-thiazole-5-carbohydrazide |
|---|---|
| PubChem CID | 24513901 |
| Molecular Formula | C22H20N4O2S |
| Molecular Weight | 404.50 g/mol |
| Exact Mass | 404.13 |
| IUPAC Name | 2-(4-ethylphenyl)-N'-(1H-indole-3-carbonyl)-4-methyl-1,3-thiazole-5-carbohydrazide |
| SMILES | CCc1ccc(-c2nc(C)c(C(=O)NNC(=O)c3c[nH]c4ccccc34)s2)cc1 |
| InChI | InChI=1S/C22H20N4O2S/c1-3-14-8-10-15(11-9-14)22-24-13(2)19(29-22)21(28)26-25-20(27)17-12-23-18-7-5-4-6-16(17)18/h4-12,23H,3H2,1-2H3,(H,25,27)(H,26,28) |
| InChIKey | ZTYNHINVYRVBLP-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 86.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.50 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|