C17H18N2O — CID 159635618
N-(4-ethylphenyl)-1H-indole-3-carboxamide;molecular hydrogen (PubChem CID 159635618) has the molecular formula C17H18N2O and a molecular weight of 266.34 g/mol. Its IUPAC name is N-(4-ethylphenyl)-1H-indole-3-carboxamide;molecular hydrogen.
| Compound Name | N-(4-ethylphenyl)-1H-indole-3-carboxamide;molecular hydrogen |
|---|---|
| PubChem CID | 159635618 |
| Molecular Formula | C17H18N2O |
| Molecular Weight | 266.34 g/mol |
| Exact Mass | 266.14 |
| IUPAC Name | N-(4-ethylphenyl)-1H-indole-3-carboxamide;molecular hydrogen |
| SMILES | CCc1ccc(NC(=O)c2c[nH]c3ccccc23)cc1.[H][H] |
| InChI | InChI=1S/C17H16N2O.H2/c1-2-12-7-9-13(10-8-12)19-17(20)15-11-18-16-6-4-3-5-14(15)16;/h3-11,18H,2H2,1H3,(H,19,20);1H |
| InChIKey | MPRYJVGCNSLNCL-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 44.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.34 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |