N-(4-ethylphenyl)-1H-indole-3-carboxamide;molecular hydrogen

C17H18N2O — CID 159635618

IUPACN-(4-ethylphenyl)-1H-indole-3-carboxamide;molecular hydrogen
SMILESCCc1ccc(NC(=O)c2c[nH]c3ccccc23)cc1.[H][H]
InChIInChI=1S/C17H16N2O.H2/c1-2-12-7-9-13(10-8-12)19-17(20)15-11-18-16-6-4-3-5-14(15)16;/h3-11,18H,2H2,1H3,(H,19,20);1H
InChIKeyMPRYJVGCNSLNCL-UHFFFAOYSA-N
MW266.34 g/mol
LogP4.23
Rot. Bonds3

About N-(4-ethylphenyl)-1H-indole-3-carboxamide;molecular hydrogen

N-(4-ethylphenyl)-1H-indole-3-carboxamide;molecular hydrogen (PubChem CID 159635618) has the molecular formula C17H18N2O and a molecular weight of 266.34 g/mol. Its IUPAC name is N-(4-ethylphenyl)-1H-indole-3-carboxamide;molecular hydrogen.

Molecular Properties

Compound NameN-(4-ethylphenyl)-1H-indole-3-carboxamide;molecular hydrogen
PubChem CID159635618
Molecular FormulaC17H18N2O
Molecular Weight266.34 g/mol
Exact Mass266.14
IUPAC NameN-(4-ethylphenyl)-1H-indole-3-carboxamide;molecular hydrogen
SMILESCCc1ccc(NC(=O)c2c[nH]c3ccccc23)cc1.[H][H]
InChIInChI=1S/C17H16N2O.H2/c1-2-12-7-9-13(10-8-12)19-17(20)15-11-18-16-6-4-3-5-14(15)16;/h3-11,18H,2H2,1H3,(H,19,20);1H
InChIKeyMPRYJVGCNSLNCL-UHFFFAOYSA-N
XLogP4.23
TPSA44.89 Ų
H-Bond Donors2
H-Bond Acceptors1
Rotatable Bonds3
Heavy Atoms20
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500266.34
LogP ≤ 54.23
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 101

Analyze N-(4-ethylphenyl)-1H-indole-3-carboxamide;molecular hydrogen with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of N-(4-ethylphenyl)-1H-indole-3-carboxamide;molecular hydrogen?
The IUPAC name of N-(4-ethylphenyl)-1H-indole-3-carboxamide;molecular hydrogen (CID 159635618) is N-(4-ethylphenyl)-1H-indole-3-carboxamide;molecular hydrogen.
What is the SMILES notation for N-(4-ethylphenyl)-1H-indole-3-carboxamide;molecular hydrogen?
The canonical SMILES for N-(4-ethylphenyl)-1H-indole-3-carboxamide;molecular hydrogen is CCc1ccc(NC(=O)c2c[nH]c3ccccc23)cc1.[H][H].
What is the InChIKey of N-(4-ethylphenyl)-1H-indole-3-carboxamide;molecular hydrogen?
The InChIKey is MPRYJVGCNSLNCL-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H16N2O.H2/c1-2-12-7-9-13(10-8-12)19-17(20)15-11-18-16-6-4-3-5-14(15)16;/h3-11,18H,2H2,1H3,(H,19,20);1H.
What are the key properties of N-(4-ethylphenyl)-1H-indole-3-carboxamide;molecular hydrogen?
N-(4-ethylphenyl)-1H-indole-3-carboxamide;molecular hydrogen has a molecular weight of 266.34 g/mol, XLogP of 4.23, 3 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-(4-ethylphenyl)-1H-indole-3-carboxamide;molecular hydrogen is sourced from PubChem (CID 159635618), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).