C14H14N4O5S — CID 108513016
N'-(4,5-dimethyl-1,3-thiazol-2-yl)-N-(2-methoxy-4-nitrophenyl)oxamide (PubChem CID 108513016) has the molecular formula C14H14N4O5S and a molecular weight of 350.36 g/mol. Its IUPAC name is N'-(4,5-dimethyl-1,3-thiazol-2-yl)-N-(2-methoxy-4-nitrophenyl)oxamide.
| Compound Name | N'-(4,5-dimethyl-1,3-thiazol-2-yl)-N-(2-methoxy-4-nitrophenyl)oxamide |
|---|---|
| PubChem CID | 108513016 |
| Molecular Formula | C14H14N4O5S |
| Molecular Weight | 350.36 g/mol |
| Exact Mass | 350.07 |
| IUPAC Name | N'-(4,5-dimethyl-1,3-thiazol-2-yl)-N-(2-methoxy-4-nitrophenyl)oxamide |
| SMILES | COc1cc([N+](=O)[O-])ccc1NC(=O)C(=O)Nc1nc(C)c(C)s1 |
| InChI | InChI=1S/C14H14N4O5S/c1-7-8(2)24-14(15-7)17-13(20)12(19)16-10-5-4-9(18(21)22)6-11(10)23-3/h4-6H,1-3H3,(H,16,19)(H,15,17,20) |
| InChIKey | ODNGOTKYTVSREH-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 123.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.36 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|