C14H15N3O3S — CID 108529987
N'-(4,5-dimethyl-1,3-thiazol-2-yl)-N-(2-hydroxy-4-methylphenyl)oxamide (PubChem CID 108529987) has the molecular formula C14H15N3O3S and a molecular weight of 305.36 g/mol. Its IUPAC name is N'-(4,5-dimethyl-1,3-thiazol-2-yl)-N-(2-hydroxy-4-methylphenyl)oxamide.
| Compound Name | N'-(4,5-dimethyl-1,3-thiazol-2-yl)-N-(2-hydroxy-4-methylphenyl)oxamide |
|---|---|
| PubChem CID | 108529987 |
| Molecular Formula | C14H15N3O3S |
| Molecular Weight | 305.36 g/mol |
| Exact Mass | 305.08 |
| IUPAC Name | N'-(4,5-dimethyl-1,3-thiazol-2-yl)-N-(2-hydroxy-4-methylphenyl)oxamide |
| SMILES | Cc1ccc(NC(=O)C(=O)Nc2nc(C)c(C)s2)c(O)c1 |
| InChI | InChI=1S/C14H15N3O3S/c1-7-4-5-10(11(18)6-7)16-12(19)13(20)17-14-15-8(2)9(3)21-14/h4-6,18H,1-3H3,(H,16,19)(H,15,17,20) |
| InChIKey | AUSAMGNSAMJYTK-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 91.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.36 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|