C13H13FN2OS — CID 79769818
N-(4,5-dimethyl-1,3-thiazol-2-yl)-2-fluoro-4-methylbenzamide (PubChem CID 79769818) has the molecular formula C13H13FN2OS and a molecular weight of 264.32 g/mol. Its IUPAC name is N-(4,5-dimethyl-1,3-thiazol-2-yl)-2-fluoro-4-methylbenzamide.
| Compound Name | N-(4,5-dimethyl-1,3-thiazol-2-yl)-2-fluoro-4-methylbenzamide |
|---|---|
| PubChem CID | 79769818 |
| Molecular Formula | C13H13FN2OS |
| Molecular Weight | 264.32 g/mol |
| Exact Mass | 264.07 |
| IUPAC Name | N-(4,5-dimethyl-1,3-thiazol-2-yl)-2-fluoro-4-methylbenzamide |
| SMILES | Cc1ccc(C(=O)Nc2nc(C)c(C)s2)c(F)c1 |
| InChI | InChI=1S/C13H13FN2OS/c1-7-4-5-10(11(14)6-7)12(17)16-13-15-8(2)9(3)18-13/h4-6H,1-3H3,(H,15,16,17) |
| InChIKey | GTEBFYYJMUWQTE-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.32 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |