C12H11FN2OS2 — CID 107024984
N-(4,5-dimethyl-1,3-thiazol-2-yl)-4-fluoro-3-sulfanylbenzamide (PubChem CID 107024984) has the molecular formula C12H11FN2OS2 and a molecular weight of 282.37 g/mol. Its IUPAC name is N-(4,5-dimethyl-1,3-thiazol-2-yl)-4-fluoro-3-sulfanylbenzamide.
| Compound Name | N-(4,5-dimethyl-1,3-thiazol-2-yl)-4-fluoro-3-sulfanylbenzamide |
|---|---|
| PubChem CID | 107024984 |
| Molecular Formula | C12H11FN2OS2 |
| Molecular Weight | 282.37 g/mol |
| Exact Mass | 282.03 |
| IUPAC Name | N-(4,5-dimethyl-1,3-thiazol-2-yl)-4-fluoro-3-sulfanylbenzamide |
| SMILES | Cc1nc(NC(=O)c2ccc(F)c(S)c2)sc1C |
| InChI | InChI=1S/C12H11FN2OS2/c1-6-7(2)18-12(14-6)15-11(16)8-3-4-9(13)10(17)5-8/h3-5,17H,1-2H3,(H,14,15,16) |
| InChIKey | CLJDVATVWZSRET-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.37 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|