C14H8ClFN2OS2 — CID 107020053
N-(6-chloro-1,3-benzothiazol-2-yl)-4-fluoro-3-sulfanylbenzamide (PubChem CID 107020053) has the molecular formula C14H8ClFN2OS2 and a molecular weight of 338.82 g/mol. Its IUPAC name is N-(6-chloro-1,3-benzothiazol-2-yl)-4-fluoro-3-sulfanylbenzamide.
| Compound Name | N-(6-chloro-1,3-benzothiazol-2-yl)-4-fluoro-3-sulfanylbenzamide |
|---|---|
| PubChem CID | 107020053 |
| Molecular Formula | C14H8ClFN2OS2 |
| Molecular Weight | 338.82 g/mol |
| Exact Mass | 337.98 |
| IUPAC Name | N-(6-chloro-1,3-benzothiazol-2-yl)-4-fluoro-3-sulfanylbenzamide |
| SMILES | O=C(Nc1nc2ccc(Cl)cc2s1)c1ccc(F)c(S)c1 |
| InChI | InChI=1S/C14H8ClFN2OS2/c15-8-2-4-10-12(6-8)21-14(17-10)18-13(19)7-1-3-9(16)11(20)5-7/h1-6,20H,(H,17,18,19) |
| InChIKey | PCLWTFIDVGMVMA-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.82 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|