C17H13ClN2OS3 — CID 8582473
N-(6-chloro-1,3-benzothiazol-2-yl)-4-(1,3-dithiolan-2-yl)benzamide (PubChem CID 8582473) has the molecular formula C17H13ClN2OS3 and a molecular weight of 392.96 g/mol. Its IUPAC name is N-(6-chloro-1,3-benzothiazol-2-yl)-4-(1,3-dithiolan-2-yl)benzamide.
| Compound Name | N-(6-chloro-1,3-benzothiazol-2-yl)-4-(1,3-dithiolan-2-yl)benzamide |
|---|---|
| PubChem CID | 8582473 |
| Molecular Formula | C17H13ClN2OS3 |
| Molecular Weight | 392.96 g/mol |
| Exact Mass | 391.99 |
| IUPAC Name | N-(6-chloro-1,3-benzothiazol-2-yl)-4-(1,3-dithiolan-2-yl)benzamide |
| SMILES | O=C(Nc1nc2ccc(Cl)cc2s1)c1ccc(C2SCCS2)cc1 |
| InChI | InChI=1S/C17H13ClN2OS3/c18-12-5-6-13-14(9-12)24-17(19-13)20-15(21)10-1-3-11(4-2-10)16-22-7-8-23-16/h1-6,9,16H,7-8H2,(H,19,20,21) |
| InChIKey | QSLYZHGMTKGSOC-UHFFFAOYSA-N |
| XLogP | 5.68 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.96 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |