C13H9ClN4OS — CID 62151620
6-amino-N-(6-chloro-1,3-benzothiazol-2-yl)pyridine-3-carboxamide (PubChem CID 62151620) has the molecular formula C13H9ClN4OS and a molecular weight of 304.76 g/mol. Its IUPAC name is 6-amino-N-(6-chloro-1,3-benzothiazol-2-yl)pyridine-3-carboxamide.
| Compound Name | 6-amino-N-(6-chloro-1,3-benzothiazol-2-yl)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 62151620 |
| Molecular Formula | C13H9ClN4OS |
| Molecular Weight | 304.76 g/mol |
| Exact Mass | 304.02 |
| IUPAC Name | 6-amino-N-(6-chloro-1,3-benzothiazol-2-yl)pyridine-3-carboxamide |
| SMILES | Nc1ccc(C(=O)Nc2nc3ccc(Cl)cc3s2)cn1 |
| InChI | InChI=1S/C13H9ClN4OS/c14-8-2-3-9-10(5-8)20-13(17-9)18-12(19)7-1-4-11(15)16-6-7/h1-6H,(H2,15,16)(H,17,18,19) |
| InChIKey | USLXJMPGTOXCCQ-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 80.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.76 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |