C13H12F3N3OS — CID 62185340
4-amino-N-(4,5-dimethyl-1,3-thiazol-2-yl)-3-(trifluoromethyl)benzamide (PubChem CID 62185340) has the molecular formula C13H12F3N3OS and a molecular weight of 315.32 g/mol. Its IUPAC name is 4-amino-N-(4,5-dimethyl-1,3-thiazol-2-yl)-3-(trifluoromethyl)benzamide.
| Compound Name | 4-amino-N-(4,5-dimethyl-1,3-thiazol-2-yl)-3-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 62185340 |
| Molecular Formula | C13H12F3N3OS |
| Molecular Weight | 315.32 g/mol |
| Exact Mass | 315.07 |
| IUPAC Name | 4-amino-N-(4,5-dimethyl-1,3-thiazol-2-yl)-3-(trifluoromethyl)benzamide |
| SMILES | Cc1nc(NC(=O)c2ccc(N)c(C(F)(F)F)c2)sc1C |
| InChI | InChI=1S/C13H12F3N3OS/c1-6-7(2)21-12(18-6)19-11(20)8-3-4-10(17)9(5-8)13(14,15)16/h3-5H,17H2,1-2H3,(H,18,19,20) |
| InChIKey | BJVLFQUNNAVZOT-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.32 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|