C10H11N3O2S — CID 82344433
5-amino-N-(4,5-dimethyl-1,3-thiazol-2-yl)furan-2-carboxamide (PubChem CID 82344433) has the molecular formula C10H11N3O2S and a molecular weight of 237.28 g/mol. Its IUPAC name is 5-amino-N-(4,5-dimethyl-1,3-thiazol-2-yl)furan-2-carboxamide.
| Compound Name | 5-amino-N-(4,5-dimethyl-1,3-thiazol-2-yl)furan-2-carboxamide |
|---|---|
| PubChem CID | 82344433 |
| Molecular Formula | C10H11N3O2S |
| Molecular Weight | 237.28 g/mol |
| Exact Mass | 237.06 |
| IUPAC Name | 5-amino-N-(4,5-dimethyl-1,3-thiazol-2-yl)furan-2-carboxamide |
| SMILES | Cc1nc(NC(=O)c2ccc(N)o2)sc1C |
| InChI | InChI=1S/C10H11N3O2S/c1-5-6(2)16-10(12-5)13-9(14)7-3-4-8(11)15-7/h3-4H,11H2,1-2H3,(H,12,13,14) |
| InChIKey | GTXRWRPAZDZCOM-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 81.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.28 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |