C13H10F2N2O2S — CID 17391508
N-(5-acetyl-4-methyl-1,3-thiazol-2-yl)-2,4-difluorobenzamide (PubChem CID 17391508) has the molecular formula C13H10F2N2O2S and a molecular weight of 296.30 g/mol. Its IUPAC name is N-(5-acetyl-4-methyl-1,3-thiazol-2-yl)-2,4-difluorobenzamide.
| Compound Name | N-(5-acetyl-4-methyl-1,3-thiazol-2-yl)-2,4-difluorobenzamide |
|---|---|
| PubChem CID | 17391508 |
| Molecular Formula | C13H10F2N2O2S |
| Molecular Weight | 296.30 g/mol |
| Exact Mass | 296.04 |
| IUPAC Name | N-(5-acetyl-4-methyl-1,3-thiazol-2-yl)-2,4-difluorobenzamide |
| SMILES | CC(=O)c1sc(NC(=O)c2ccc(F)cc2F)nc1C |
| InChI | InChI=1S/C13H10F2N2O2S/c1-6-11(7(2)18)20-13(16-6)17-12(19)9-4-3-8(14)5-10(9)15/h3-5H,1-2H3,(H,16,17,19) |
| InChIKey | OAVJKKDXYHPCFI-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.30 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |