C12H11FN4O3S — CID 62185341
5-amino-N-(4,5-dimethyl-1,3-thiazol-2-yl)-4-fluoro-2-nitrobenzamide (PubChem CID 62185341) has the molecular formula C12H11FN4O3S and a molecular weight of 310.31 g/mol. Its IUPAC name is 5-amino-N-(4,5-dimethyl-1,3-thiazol-2-yl)-4-fluoro-2-nitrobenzamide.
| Compound Name | 5-amino-N-(4,5-dimethyl-1,3-thiazol-2-yl)-4-fluoro-2-nitrobenzamide |
|---|---|
| PubChem CID | 62185341 |
| Molecular Formula | C12H11FN4O3S |
| Molecular Weight | 310.31 g/mol |
| Exact Mass | 310.05 |
| IUPAC Name | 5-amino-N-(4,5-dimethyl-1,3-thiazol-2-yl)-4-fluoro-2-nitrobenzamide |
| SMILES | Cc1nc(NC(=O)c2cc(N)c(F)cc2[N+](=O)[O-])sc1C |
| InChI | InChI=1S/C12H11FN4O3S/c1-5-6(2)21-12(15-5)16-11(18)7-3-9(14)8(13)4-10(7)17(19)20/h3-4H,14H2,1-2H3,(H,15,16,18) |
| InChIKey | YEUPHAVWVQUECV-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 111.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.31 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|