C9H5F2N5O3S — CID 79515712
N-(5-amino-1,3,4-thiadiazol-2-yl)-4,5-difluoro-2-nitrobenzamide (PubChem CID 79515712) has the molecular formula C9H5F2N5O3S and a molecular weight of 301.23 g/mol. Its IUPAC name is N-(5-amino-1,3,4-thiadiazol-2-yl)-4,5-difluoro-2-nitrobenzamide.
| Compound Name | N-(5-amino-1,3,4-thiadiazol-2-yl)-4,5-difluoro-2-nitrobenzamide |
|---|---|
| PubChem CID | 79515712 |
| Molecular Formula | C9H5F2N5O3S |
| Molecular Weight | 301.23 g/mol |
| Exact Mass | 301.01 |
| IUPAC Name | N-(5-amino-1,3,4-thiadiazol-2-yl)-4,5-difluoro-2-nitrobenzamide |
| SMILES | Nc1nnc(NC(=O)c2cc(F)c(F)cc2[N+](=O)[O-])s1 |
| InChI | InChI=1S/C9H5F2N5O3S/c10-4-1-3(6(16(18)19)2-5(4)11)7(17)13-9-15-14-8(12)20-9/h1-2H,(H2,12,14)(H,13,15,17) |
| InChIKey | PKZFEEFQGACQPR-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 124.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.23 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|