C7H5N5O3S2 — CID 114033605
N-(5-amino-1,3,4-thiadiazol-2-yl)-5-nitrothiophene-2-carboxamide (PubChem CID 114033605) has the molecular formula C7H5N5O3S2 and a molecular weight of 271.28 g/mol. Its IUPAC name is N-(5-amino-1,3,4-thiadiazol-2-yl)-5-nitrothiophene-2-carboxamide.
| Compound Name | N-(5-amino-1,3,4-thiadiazol-2-yl)-5-nitrothiophene-2-carboxamide |
|---|---|
| PubChem CID | 114033605 |
| Molecular Formula | C7H5N5O3S2 |
| Molecular Weight | 271.28 g/mol |
| Exact Mass | 270.98 |
| IUPAC Name | N-(5-amino-1,3,4-thiadiazol-2-yl)-5-nitrothiophene-2-carboxamide |
| SMILES | Nc1nnc(NC(=O)c2ccc([N+](=O)[O-])s2)s1 |
| InChI | InChI=1S/C7H5N5O3S2/c8-6-10-11-7(17-6)9-5(13)3-1-2-4(16-3)12(14)15/h1-2H,(H2,8,10)(H,9,11,13) |
| InChIKey | TZDWGOMHBLXHKU-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 124.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.28 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|