C16H10Cl2N6O7S4 — CID 158781725
5-chloro-N-(5-nitro-1,3-thiazol-2-yl)thiophene-2-carboxamide;5-chlorothiophene-2-carboxylic acid;5-nitro-1,3-thiazol-2-amine (PubChem CID 158781725) has the molecular formula C16H10Cl2N6O7S4 and a molecular weight of 597.47 g/mol. Its IUPAC name is 5-chloro-N-(5-nitro-1,3-thiazol-2-yl)thiophene-2-carboxamide;5-chlorothiophene-2-carboxylic acid;5-nitro-1,3-thiazol-2-amine.
| Compound Name | 5-chloro-N-(5-nitro-1,3-thiazol-2-yl)thiophene-2-carboxamide;5-chlorothiophene-2-carboxylic acid;5-nitro-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 158781725 |
| Molecular Formula | C16H10Cl2N6O7S4 |
| Molecular Weight | 597.47 g/mol |
| Exact Mass | 595.89 |
| IUPAC Name | 5-chloro-N-(5-nitro-1,3-thiazol-2-yl)thiophene-2-carboxamide;5-chlorothiophene-2-carboxylic acid;5-nitro-1,3-thiazol-2-amine |
| SMILES | Nc1ncc([N+](=O)[O-])s1.O=C(Nc1ncc([N+](=O)[O-])s1)c1ccc(Cl)s1.O=C(O)c1ccc(Cl)s1 |
| InChI | InChI=1S/C8H4ClN3O3S2.C5H3ClO2S.C3H3N3O2S/c9-5-2-1-4(16-5)7(13)11-8-10-3-6(17-8)12(14)15;6-4-2-1-3(9-4)5(7)8;4-3-5-1-2(9-3)6(7)8/h1-3H,(H,10,11,13);1-2H,(H,7,8);1H,(H2,4,5) |
| InChIKey | IRDZETGHIPAXLX-UHFFFAOYSA-N |
| XLogP | 5.75 |
| TPSA | 204.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 597.47 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|