C9H4F2N4O3S — CID 105380941
2,3-difluoro-N-(5-nitro-1,3-thiazol-2-yl)pyridine-4-carboxamide (PubChem CID 105380941) has the molecular formula C9H4F2N4O3S and a molecular weight of 286.22 g/mol. Its IUPAC name is 2,3-difluoro-N-(5-nitro-1,3-thiazol-2-yl)pyridine-4-carboxamide.
| Compound Name | 2,3-difluoro-N-(5-nitro-1,3-thiazol-2-yl)pyridine-4-carboxamide |
|---|---|
| PubChem CID | 105380941 |
| Molecular Formula | C9H4F2N4O3S |
| Molecular Weight | 286.22 g/mol |
| Exact Mass | 286.00 |
| IUPAC Name | 2,3-difluoro-N-(5-nitro-1,3-thiazol-2-yl)pyridine-4-carboxamide |
| SMILES | O=C(Nc1ncc([N+](=O)[O-])s1)c1ccnc(F)c1F |
| InChI | InChI=1S/C9H4F2N4O3S/c10-6-4(1-2-12-7(6)11)8(16)14-9-13-3-5(19-9)15(17)18/h1-3H,(H,13,14,16) |
| InChIKey | MWXWFACGTDIAJL-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 98.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.22 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|