C8H4N4O6S — CID 3749457
5-nitro-N-(5-nitro-1,3-thiazol-2-yl)furan-2-carboxamide (PubChem CID 3749457) has the molecular formula C8H4N4O6S and a molecular weight of 284.21 g/mol. Its IUPAC name is 5-nitro-N-(5-nitro-1,3-thiazol-2-yl)furan-2-carboxamide.
| Compound Name | 5-nitro-N-(5-nitro-1,3-thiazol-2-yl)furan-2-carboxamide |
|---|---|
| PubChem CID | 3749457 |
| Molecular Formula | C8H4N4O6S |
| Molecular Weight | 284.21 g/mol |
| Exact Mass | 283.99 |
| IUPAC Name | 5-nitro-N-(5-nitro-1,3-thiazol-2-yl)furan-2-carboxamide |
| SMILES | O=C(Nc1ncc([N+](=O)[O-])s1)c1ccc([N+](=O)[O-])o1 |
| InChI | InChI=1S/C8H4N4O6S/c13-7(4-1-2-5(18-4)11(14)15)10-8-9-3-6(19-8)12(16)17/h1-3H,(H,9,10,13) |
| InChIKey | NRCXOZCUBHZNJE-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 141.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.21 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|