C12H6BrN3O4S2 — CID 2323203
N-[4-(5-bromothiophen-2-yl)-1,3-thiazol-2-yl]-5-nitrofuran-2-carboxamide (PubChem CID 2323203) has the molecular formula C12H6BrN3O4S2 and a molecular weight of 400.24 g/mol. Its IUPAC name is N-[4-(5-bromothiophen-2-yl)-1,3-thiazol-2-yl]-5-nitrofuran-2-carboxamide.
| Compound Name | N-[4-(5-bromothiophen-2-yl)-1,3-thiazol-2-yl]-5-nitrofuran-2-carboxamide |
|---|---|
| PubChem CID | 2323203 |
| Molecular Formula | C12H6BrN3O4S2 |
| Molecular Weight | 400.24 g/mol |
| Exact Mass | 398.90 |
| IUPAC Name | N-[4-(5-bromothiophen-2-yl)-1,3-thiazol-2-yl]-5-nitrofuran-2-carboxamide |
| SMILES | O=C(Nc1nc(-c2ccc(Br)s2)cs1)c1ccc([N+](=O)[O-])o1 |
| InChI | InChI=1S/C12H6BrN3O4S2/c13-9-3-2-8(22-9)6-5-21-12(14-6)15-11(17)7-1-4-10(20-7)16(18)19/h1-5H,(H,14,15,17) |
| InChIKey | BCUODIYIQODXNY-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 98.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.24 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|