C21H14BrN3O4S — CID 137463397
N-[5-(4-bromophenyl)-4-(4-methylphenyl)-1,3-thiazol-2-yl]-5-nitrofuran-2-carboxamide (PubChem CID 137463397) has the molecular formula C21H14BrN3O4S and a molecular weight of 484.33 g/mol. Its IUPAC name is N-[5-(4-bromophenyl)-4-(4-methylphenyl)-1,3-thiazol-2-yl]-5-nitrofuran-2-carboxamide.
| Compound Name | N-[5-(4-bromophenyl)-4-(4-methylphenyl)-1,3-thiazol-2-yl]-5-nitrofuran-2-carboxamide |
|---|---|
| PubChem CID | 137463397 |
| Molecular Formula | C21H14BrN3O4S |
| Molecular Weight | 484.33 g/mol |
| Exact Mass | 482.99 |
| IUPAC Name | N-[5-(4-bromophenyl)-4-(4-methylphenyl)-1,3-thiazol-2-yl]-5-nitrofuran-2-carboxamide |
| SMILES | Cc1ccc(-c2nc(NC(=O)c3ccc([N+](=O)[O-])o3)sc2-c2ccc(Br)cc2)cc1 |
| InChI | InChI=1S/C21H14BrN3O4S/c1-12-2-4-13(5-3-12)18-19(14-6-8-15(22)9-7-14)30-21(23-18)24-20(26)16-10-11-17(29-16)25(27)28/h2-11H,1H3,(H,23,24,26) |
| InChIKey | UIDDAXZOAKSDAT-UHFFFAOYSA-N |
| XLogP | 6.30 |
| TPSA | 98.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.33 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|