C12H9ClN4O4S — CID 156613225
N-(6-amino-1,3-benzothiazol-2-yl)-5-nitrofuran-2-carboxamide;hydrochloride (PubChem CID 156613225) has the molecular formula C12H9ClN4O4S and a molecular weight of 340.75 g/mol. Its IUPAC name is N-(6-amino-1,3-benzothiazol-2-yl)-5-nitrofuran-2-carboxamide;hydrochloride.
| Compound Name | N-(6-amino-1,3-benzothiazol-2-yl)-5-nitrofuran-2-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 156613225 |
| Molecular Formula | C12H9ClN4O4S |
| Molecular Weight | 340.75 g/mol |
| Exact Mass | 340.00 |
| IUPAC Name | N-(6-amino-1,3-benzothiazol-2-yl)-5-nitrofuran-2-carboxamide;hydrochloride |
| SMILES | Cl.Nc1ccc2nc(NC(=O)c3ccc([N+](=O)[O-])o3)sc2c1 |
| InChI | InChI=1S/C12H8N4O4S.ClH/c13-6-1-2-7-9(5-6)21-12(14-7)15-11(17)8-3-4-10(20-8)16(18)19;/h1-5H,13H2,(H,14,15,17);1H |
| InChIKey | GHEVFRVUSOOAGM-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 124.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.75 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|