C14H17N5O4S — CID 5495958
N-[5-(cyclohexylmethylamino)-1,3,4-thiadiazol-2-yl]-5-nitrofuran-2-carboxamide (PubChem CID 5495958) has the molecular formula C14H17N5O4S and a molecular weight of 351.39 g/mol. Its IUPAC name is N-[5-(cyclohexylmethylamino)-1,3,4-thiadiazol-2-yl]-5-nitrofuran-2-carboxamide.
| Compound Name | N-[5-(cyclohexylmethylamino)-1,3,4-thiadiazol-2-yl]-5-nitrofuran-2-carboxamide |
|---|---|
| PubChem CID | 5495958 |
| Molecular Formula | C14H17N5O4S |
| Molecular Weight | 351.39 g/mol |
| Exact Mass | 351.10 |
| IUPAC Name | N-[5-(cyclohexylmethylamino)-1,3,4-thiadiazol-2-yl]-5-nitrofuran-2-carboxamide |
| SMILES | O=C(Nc1nnc(NCC2CCCCC2)s1)c1ccc([N+](=O)[O-])o1 |
| InChI | InChI=1S/C14H17N5O4S/c20-12(10-6-7-11(23-10)19(21)22)16-14-18-17-13(24-14)15-8-9-4-2-1-3-5-9/h6-7,9H,1-5,8H2,(H,15,17)(H,16,18,20) |
| InChIKey | LKCLJFPUEWMRPP-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 123.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.39 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|