C18H17N3O6S2 — CID 16850297
N-[4-[(3,5-dimethoxyphenyl)methylsulfanylmethyl]-1,3-thiazol-2-yl]-5-nitrofuran-2-carboxamide (PubChem CID 16850297) has the molecular formula C18H17N3O6S2 and a molecular weight of 435.48 g/mol. Its IUPAC name is N-[4-[(3,5-dimethoxyphenyl)methylsulfanylmethyl]-1,3-thiazol-2-yl]-5-nitrofuran-2-carboxamide.
| Compound Name | N-[4-[(3,5-dimethoxyphenyl)methylsulfanylmethyl]-1,3-thiazol-2-yl]-5-nitrofuran-2-carboxamide |
|---|---|
| PubChem CID | 16850297 |
| Molecular Formula | C18H17N3O6S2 |
| Molecular Weight | 435.48 g/mol |
| Exact Mass | 435.06 |
| IUPAC Name | N-[4-[(3,5-dimethoxyphenyl)methylsulfanylmethyl]-1,3-thiazol-2-yl]-5-nitrofuran-2-carboxamide |
| SMILES | COc1cc(CSCc2csc(NC(=O)c3ccc([N+](=O)[O-])o3)n2)cc(OC)c1 |
| InChI | InChI=1S/C18H17N3O6S2/c1-25-13-5-11(6-14(7-13)26-2)8-28-9-12-10-29-18(19-12)20-17(22)15-3-4-16(27-15)21(23)24/h3-7,10H,8-9H2,1-2H3,(H,19,20,22) |
| InChIKey | GMMYKFJUEOPDNY-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 116.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.48 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|