C22H23FN2O2S2 — CID 16850091
4-butoxy-N-[4-[(4-fluorophenyl)methylsulfanylmethyl]-1,3-thiazol-2-yl]benzamide (PubChem CID 16850091) has the molecular formula C22H23FN2O2S2 and a molecular weight of 430.57 g/mol. Its IUPAC name is 4-butoxy-N-[4-[(4-fluorophenyl)methylsulfanylmethyl]-1,3-thiazol-2-yl]benzamide.
| Compound Name | 4-butoxy-N-[4-[(4-fluorophenyl)methylsulfanylmethyl]-1,3-thiazol-2-yl]benzamide |
|---|---|
| PubChem CID | 16850091 |
| Molecular Formula | C22H23FN2O2S2 |
| Molecular Weight | 430.57 g/mol |
| Exact Mass | 430.12 |
| IUPAC Name | 4-butoxy-N-[4-[(4-fluorophenyl)methylsulfanylmethyl]-1,3-thiazol-2-yl]benzamide |
| SMILES | CCCCOc1ccc(C(=O)Nc2nc(CSCc3ccc(F)cc3)cs2)cc1 |
| InChI | InChI=1S/C22H23FN2O2S2/c1-2-3-12-27-20-10-6-17(7-11-20)21(26)25-22-24-19(15-29-22)14-28-13-16-4-8-18(23)9-5-16/h4-11,15H,2-3,12-14H2,1H3,(H,24,25,26) |
| InChIKey | AKEXRJRGDYRFEO-UHFFFAOYSA-N |
| XLogP | 6.15 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.57 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|