C20H27N3O2S — CID 30183318
4-butoxy-N-[4-(piperidin-1-ylmethyl)-1,3-thiazol-2-yl]benzamide (PubChem CID 30183318) has the molecular formula C20H27N3O2S and a molecular weight of 373.52 g/mol. Its IUPAC name is 4-butoxy-N-[4-(piperidin-1-ylmethyl)-1,3-thiazol-2-yl]benzamide.
| Compound Name | 4-butoxy-N-[4-(piperidin-1-ylmethyl)-1,3-thiazol-2-yl]benzamide |
|---|---|
| PubChem CID | 30183318 |
| Molecular Formula | C20H27N3O2S |
| Molecular Weight | 373.52 g/mol |
| Exact Mass | 373.18 |
| IUPAC Name | 4-butoxy-N-[4-(piperidin-1-ylmethyl)-1,3-thiazol-2-yl]benzamide |
| SMILES | CCCCOc1ccc(C(=O)Nc2nc(CN3CCCCC3)cs2)cc1 |
| InChI | InChI=1S/C20H27N3O2S/c1-2-3-13-25-18-9-7-16(8-10-18)19(24)22-20-21-17(15-26-20)14-23-11-5-4-6-12-23/h7-10,15H,2-6,11-14H2,1H3,(H,21,22,24) |
| InChIKey | NHYZFDUYOXOOIF-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.52 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|