C18H21N3O3S — CID 138001675
3-[[4-(azepan-1-ylmethyl)-1,3-thiazol-2-yl]carbamoyl]benzoic acid (PubChem CID 138001675) has the molecular formula C18H21N3O3S and a molecular weight of 359.45 g/mol. Its IUPAC name is 3-[[4-(azepan-1-ylmethyl)-1,3-thiazol-2-yl]carbamoyl]benzoic acid.
| Compound Name | 3-[[4-(azepan-1-ylmethyl)-1,3-thiazol-2-yl]carbamoyl]benzoic acid |
|---|---|
| PubChem CID | 138001675 |
| Molecular Formula | C18H21N3O3S |
| Molecular Weight | 359.45 g/mol |
| Exact Mass | 359.13 |
| IUPAC Name | 3-[[4-(azepan-1-ylmethyl)-1,3-thiazol-2-yl]carbamoyl]benzoic acid |
| SMILES | O=C(O)c1cccc(C(=O)Nc2nc(CN3CCCCCC3)cs2)c1 |
| InChI | InChI=1S/C18H21N3O3S/c22-16(13-6-5-7-14(10-13)17(23)24)20-18-19-15(12-25-18)11-21-8-3-1-2-4-9-21/h5-7,10,12H,1-4,8-9,11H2,(H,23,24)(H,19,20,22) |
| InChIKey | YRCGGHHIKFWQOL-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 82.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.45 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |