C16H19N3O2S — CID 134051886
2-hydroxy-N-[4-(piperidin-1-ylmethyl)-1,3-thiazol-2-yl]benzamide (PubChem CID 134051886) has the molecular formula C16H19N3O2S and a molecular weight of 317.41 g/mol. Its IUPAC name is 2-hydroxy-N-[4-(piperidin-1-ylmethyl)-1,3-thiazol-2-yl]benzamide.
| Compound Name | 2-hydroxy-N-[4-(piperidin-1-ylmethyl)-1,3-thiazol-2-yl]benzamide |
|---|---|
| PubChem CID | 134051886 |
| Molecular Formula | C16H19N3O2S |
| Molecular Weight | 317.41 g/mol |
| Exact Mass | 317.12 |
| IUPAC Name | 2-hydroxy-N-[4-(piperidin-1-ylmethyl)-1,3-thiazol-2-yl]benzamide |
| SMILES | O=C(Nc1nc(CN2CCCCC2)cs1)c1ccccc1O |
| InChI | InChI=1S/C16H19N3O2S/c20-14-7-3-2-6-13(14)15(21)18-16-17-12(11-22-16)10-19-8-4-1-5-9-19/h2-3,6-7,11,20H,1,4-5,8-10H2,(H,17,18,21) |
| InChIKey | ZWJQSYHUZRKETH-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 65.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.41 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |