C23H22N4OS — CID 29329498
2-(2-cyanophenyl)-N-[4-(piperidin-1-ylmethyl)-1,3-thiazol-2-yl]benzamide (PubChem CID 29329498) has the molecular formula C23H22N4OS and a molecular weight of 402.52 g/mol. Its IUPAC name is 2-(2-cyanophenyl)-N-[4-(piperidin-1-ylmethyl)-1,3-thiazol-2-yl]benzamide.
| Compound Name | 2-(2-cyanophenyl)-N-[4-(piperidin-1-ylmethyl)-1,3-thiazol-2-yl]benzamide |
|---|---|
| PubChem CID | 29329498 |
| Molecular Formula | C23H22N4OS |
| Molecular Weight | 402.52 g/mol |
| Exact Mass | 402.15 |
| IUPAC Name | 2-(2-cyanophenyl)-N-[4-(piperidin-1-ylmethyl)-1,3-thiazol-2-yl]benzamide |
| SMILES | N#Cc1ccccc1-c1ccccc1C(=O)Nc1nc(CN2CCCCC2)cs1 |
| InChI | InChI=1S/C23H22N4OS/c24-14-17-8-2-3-9-19(17)20-10-4-5-11-21(20)22(28)26-23-25-18(16-29-23)15-27-12-6-1-7-13-27/h2-5,8-11,16H,1,6-7,12-13,15H2,(H,25,26,28) |
| InChIKey | SPAGWXYXEPWXCO-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 69.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.52 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |