C16H17ClN4O3S — CID 78775864
2-chloro-5-nitro-N-[4-(piperidin-1-ylmethyl)-1,3-thiazol-2-yl]benzamide (PubChem CID 78775864) has the molecular formula C16H17ClN4O3S and a molecular weight of 380.86 g/mol. Its IUPAC name is 2-chloro-5-nitro-N-[4-(piperidin-1-ylmethyl)-1,3-thiazol-2-yl]benzamide.
| Compound Name | 2-chloro-5-nitro-N-[4-(piperidin-1-ylmethyl)-1,3-thiazol-2-yl]benzamide |
|---|---|
| PubChem CID | 78775864 |
| Molecular Formula | C16H17ClN4O3S |
| Molecular Weight | 380.86 g/mol |
| Exact Mass | 380.07 |
| IUPAC Name | 2-chloro-5-nitro-N-[4-(piperidin-1-ylmethyl)-1,3-thiazol-2-yl]benzamide |
| SMILES | O=C(Nc1nc(CN2CCCCC2)cs1)c1cc([N+](=O)[O-])ccc1Cl |
| InChI | InChI=1S/C16H17ClN4O3S/c17-14-5-4-12(21(23)24)8-13(14)15(22)19-16-18-11(10-25-16)9-20-6-2-1-3-7-20/h4-5,8,10H,1-3,6-7,9H2,(H,18,19,22) |
| InChIKey | LMIXMRKLTDBSAA-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 88.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.86 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|