C20H22N4OS — CID 30183729
N-[4-(piperidin-1-ylmethyl)-1,3-thiazol-2-yl]-4-pyrrol-1-ylbenzamide (PubChem CID 30183729) has the molecular formula C20H22N4OS and a molecular weight of 366.49 g/mol. Its IUPAC name is N-[4-(piperidin-1-ylmethyl)-1,3-thiazol-2-yl]-4-pyrrol-1-ylbenzamide.
| Compound Name | N-[4-(piperidin-1-ylmethyl)-1,3-thiazol-2-yl]-4-pyrrol-1-ylbenzamide |
|---|---|
| PubChem CID | 30183729 |
| Molecular Formula | C20H22N4OS |
| Molecular Weight | 366.49 g/mol |
| Exact Mass | 366.15 |
| IUPAC Name | N-[4-(piperidin-1-ylmethyl)-1,3-thiazol-2-yl]-4-pyrrol-1-ylbenzamide |
| SMILES | O=C(Nc1nc(CN2CCCCC2)cs1)c1ccc(-n2cccc2)cc1 |
| InChI | InChI=1S/C20H22N4OS/c25-19(16-6-8-18(9-7-16)24-12-4-5-13-24)22-20-21-17(15-26-20)14-23-10-2-1-3-11-23/h4-9,12-13,15H,1-3,10-11,14H2,(H,21,22,25) |
| InChIKey | PLWYHOJNYJASAB-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 50.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.49 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |