C20H19IN2O3S2 — CID 16850229
N-[4-[(3,5-dimethoxyphenyl)methylsulfanylmethyl]-1,3-thiazol-2-yl]-2-iodobenzamide (PubChem CID 16850229) has the molecular formula C20H19IN2O3S2 and a molecular weight of 526.42 g/mol. Its IUPAC name is N-[4-[(3,5-dimethoxyphenyl)methylsulfanylmethyl]-1,3-thiazol-2-yl]-2-iodobenzamide.
| Compound Name | N-[4-[(3,5-dimethoxyphenyl)methylsulfanylmethyl]-1,3-thiazol-2-yl]-2-iodobenzamide |
|---|---|
| PubChem CID | 16850229 |
| Molecular Formula | C20H19IN2O3S2 |
| Molecular Weight | 526.42 g/mol |
| Exact Mass | 525.99 |
| IUPAC Name | N-[4-[(3,5-dimethoxyphenyl)methylsulfanylmethyl]-1,3-thiazol-2-yl]-2-iodobenzamide |
| SMILES | COc1cc(CSCc2csc(NC(=O)c3ccccc3I)n2)cc(OC)c1 |
| InChI | InChI=1S/C20H19IN2O3S2/c1-25-15-7-13(8-16(9-15)26-2)10-27-11-14-12-28-20(22-14)23-19(24)17-5-3-4-6-18(17)21/h3-9,12H,10-11H2,1-2H3,(H,22,23,24) |
| InChIKey | ZICIBPUKZSDXSR-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.42 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|