C12H10IN3O2S — CID 77046786
N-[4-(N-hydroxy-C-methylcarbonimidoyl)-1,3-thiazol-2-yl]-2-iodobenzamide (PubChem CID 77046786) has the molecular formula C12H10IN3O2S and a molecular weight of 387.20 g/mol. Its IUPAC name is N-[4-(N-hydroxy-C-methylcarbonimidoyl)-1,3-thiazol-2-yl]-2-iodobenzamide.
| Compound Name | N-[4-(N-hydroxy-C-methylcarbonimidoyl)-1,3-thiazol-2-yl]-2-iodobenzamide |
|---|---|
| PubChem CID | 77046786 |
| Molecular Formula | C12H10IN3O2S |
| Molecular Weight | 387.20 g/mol |
| Exact Mass | 386.95 |
| IUPAC Name | N-[4-(N-hydroxy-C-methylcarbonimidoyl)-1,3-thiazol-2-yl]-2-iodobenzamide |
| SMILES | CC(=NO)c1csc(NC(=O)c2ccccc2I)n1 |
| InChI | InChI=1S/C12H10IN3O2S/c1-7(16-18)10-6-19-12(14-10)15-11(17)8-4-2-3-5-9(8)13/h2-6,18H,1H3,(H,14,15,17) |
| InChIKey | ULJFTCNBBPDLFN-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 74.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.20 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|