C14H11N3O2S2 — CID 77046971
N-[4-(N-hydroxy-C-methylcarbonimidoyl)-1,3-thiazol-2-yl]-1-benzothiophene-3-carboxamide (PubChem CID 77046971) has the molecular formula C14H11N3O2S2 and a molecular weight of 317.40 g/mol. Its IUPAC name is N-[4-(N-hydroxy-C-methylcarbonimidoyl)-1,3-thiazol-2-yl]-1-benzothiophene-3-carboxamide.
| Compound Name | N-[4-(N-hydroxy-C-methylcarbonimidoyl)-1,3-thiazol-2-yl]-1-benzothiophene-3-carboxamide |
|---|---|
| PubChem CID | 77046971 |
| Molecular Formula | C14H11N3O2S2 |
| Molecular Weight | 317.40 g/mol |
| Exact Mass | 317.03 |
| IUPAC Name | N-[4-(N-hydroxy-C-methylcarbonimidoyl)-1,3-thiazol-2-yl]-1-benzothiophene-3-carboxamide |
| SMILES | CC(=NO)c1csc(NC(=O)c2csc3ccccc23)n1 |
| InChI | InChI=1S/C14H11N3O2S2/c1-8(17-19)11-7-21-14(15-11)16-13(18)10-6-20-12-5-3-2-4-9(10)12/h2-7,19H,1H3,(H,15,16,18) |
| InChIKey | XMPNRAUZSWXILN-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 74.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.40 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|