C12H9Cl2N3O2S — CID 77047033
3,5-dichloro-N-[4-(N-hydroxy-C-methylcarbonimidoyl)-1,3-thiazol-2-yl]benzamide (PubChem CID 77047033) has the molecular formula C12H9Cl2N3O2S and a molecular weight of 330.20 g/mol. Its IUPAC name is 3,5-dichloro-N-[4-(N-hydroxy-C-methylcarbonimidoyl)-1,3-thiazol-2-yl]benzamide.
| Compound Name | 3,5-dichloro-N-[4-(N-hydroxy-C-methylcarbonimidoyl)-1,3-thiazol-2-yl]benzamide |
|---|---|
| PubChem CID | 77047033 |
| Molecular Formula | C12H9Cl2N3O2S |
| Molecular Weight | 330.20 g/mol |
| Exact Mass | 328.98 |
| IUPAC Name | 3,5-dichloro-N-[4-(N-hydroxy-C-methylcarbonimidoyl)-1,3-thiazol-2-yl]benzamide |
| SMILES | CC(=NO)c1csc(NC(=O)c2cc(Cl)cc(Cl)c2)n1 |
| InChI | InChI=1S/C12H9Cl2N3O2S/c1-6(17-19)10-5-20-12(15-10)16-11(18)7-2-8(13)4-9(14)3-7/h2-5,19H,1H3,(H,15,16,18) |
| InChIKey | QTYRHHORQHCYGA-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 74.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.20 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|