C13H11ClN2O2S — CID 81003654
N-(4-acetyl-1,3-thiazol-2-yl)-3-chloro-5-methylbenzamide (PubChem CID 81003654) has the molecular formula C13H11ClN2O2S and a molecular weight of 294.76 g/mol. Its IUPAC name is N-(4-acetyl-1,3-thiazol-2-yl)-3-chloro-5-methylbenzamide.
| Compound Name | N-(4-acetyl-1,3-thiazol-2-yl)-3-chloro-5-methylbenzamide |
|---|---|
| PubChem CID | 81003654 |
| Molecular Formula | C13H11ClN2O2S |
| Molecular Weight | 294.76 g/mol |
| Exact Mass | 294.02 |
| IUPAC Name | N-(4-acetyl-1,3-thiazol-2-yl)-3-chloro-5-methylbenzamide |
| SMILES | CC(=O)c1csc(NC(=O)c2cc(C)cc(Cl)c2)n1 |
| InChI | InChI=1S/C13H11ClN2O2S/c1-7-3-9(5-10(14)4-7)12(18)16-13-15-11(6-19-13)8(2)17/h3-6H,1-2H3,(H,15,16,18) |
| InChIKey | WSLYPPZEBMHGRM-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.76 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |