C12H9Cl2N3O2S — CID 82832519
N-(4-acetyl-1,3-thiazol-2-yl)-4-amino-3,5-dichlorobenzamide (PubChem CID 82832519) has the molecular formula C12H9Cl2N3O2S and a molecular weight of 330.20 g/mol. Its IUPAC name is N-(4-acetyl-1,3-thiazol-2-yl)-4-amino-3,5-dichlorobenzamide.
| Compound Name | N-(4-acetyl-1,3-thiazol-2-yl)-4-amino-3,5-dichlorobenzamide |
|---|---|
| PubChem CID | 82832519 |
| Molecular Formula | C12H9Cl2N3O2S |
| Molecular Weight | 330.20 g/mol |
| Exact Mass | 328.98 |
| IUPAC Name | N-(4-acetyl-1,3-thiazol-2-yl)-4-amino-3,5-dichlorobenzamide |
| SMILES | CC(=O)c1csc(NC(=O)c2cc(Cl)c(N)c(Cl)c2)n1 |
| InChI | InChI=1S/C12H9Cl2N3O2S/c1-5(18)9-4-20-12(16-9)17-11(19)6-2-7(13)10(15)8(14)3-6/h2-4H,15H2,1H3,(H,16,17,19) |
| InChIKey | ZKQBOAQPZMXBNI-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 85.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.20 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|