C12H8FN3O4S — CID 78953289
N-(4-acetyl-1,3-thiazol-2-yl)-3-fluoro-5-nitrobenzamide (PubChem CID 78953289) has the molecular formula C12H8FN3O4S and a molecular weight of 309.28 g/mol. Its IUPAC name is N-(4-acetyl-1,3-thiazol-2-yl)-3-fluoro-5-nitrobenzamide.
| Compound Name | N-(4-acetyl-1,3-thiazol-2-yl)-3-fluoro-5-nitrobenzamide |
|---|---|
| PubChem CID | 78953289 |
| Molecular Formula | C12H8FN3O4S |
| Molecular Weight | 309.28 g/mol |
| Exact Mass | 309.02 |
| IUPAC Name | N-(4-acetyl-1,3-thiazol-2-yl)-3-fluoro-5-nitrobenzamide |
| SMILES | CC(=O)c1csc(NC(=O)c2cc(F)cc([N+](=O)[O-])c2)n1 |
| InChI | InChI=1S/C12H8FN3O4S/c1-6(17)10-5-21-12(14-10)15-11(18)7-2-8(13)4-9(3-7)16(19)20/h2-5H,1H3,(H,14,15,18) |
| InChIKey | SSEXENGRLLNEAV-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 102.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.28 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|