C13H13N5O5S — CID 110832067
N-[4-(2-aminopropyl)-1,3-thiazol-2-yl]-3,5-dinitrobenzamide (PubChem CID 110832067) has the molecular formula C13H13N5O5S and a molecular weight of 351.34 g/mol. Its IUPAC name is N-[4-(2-aminopropyl)-1,3-thiazol-2-yl]-3,5-dinitrobenzamide.
| Compound Name | N-[4-(2-aminopropyl)-1,3-thiazol-2-yl]-3,5-dinitrobenzamide |
|---|---|
| PubChem CID | 110832067 |
| Molecular Formula | C13H13N5O5S |
| Molecular Weight | 351.34 g/mol |
| Exact Mass | 351.06 |
| IUPAC Name | N-[4-(2-aminopropyl)-1,3-thiazol-2-yl]-3,5-dinitrobenzamide |
| SMILES | CC(N)Cc1csc(NC(=O)c2cc([N+](=O)[O-])cc([N+](=O)[O-])c2)n1 |
| InChI | InChI=1S/C13H13N5O5S/c1-7(14)2-9-6-24-13(15-9)16-12(19)8-3-10(17(20)21)5-11(4-8)18(22)23/h3-7H,2,14H2,1H3,(H,15,16,19) |
| InChIKey | AAQKSWTXIAGFDI-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 154.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.34 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|