C11H11N3O2S2 — CID 77047051
N-[4-(N-hydroxy-C-methylcarbonimidoyl)-1,3-thiazol-2-yl]-3-methylthiophene-2-carboxamide (PubChem CID 77047051) has the molecular formula C11H11N3O2S2 and a molecular weight of 281.36 g/mol. Its IUPAC name is N-[4-(N-hydroxy-C-methylcarbonimidoyl)-1,3-thiazol-2-yl]-3-methylthiophene-2-carboxamide.
| Compound Name | N-[4-(N-hydroxy-C-methylcarbonimidoyl)-1,3-thiazol-2-yl]-3-methylthiophene-2-carboxamide |
|---|---|
| PubChem CID | 77047051 |
| Molecular Formula | C11H11N3O2S2 |
| Molecular Weight | 281.36 g/mol |
| Exact Mass | 281.03 |
| IUPAC Name | N-[4-(N-hydroxy-C-methylcarbonimidoyl)-1,3-thiazol-2-yl]-3-methylthiophene-2-carboxamide |
| SMILES | CC(=NO)c1csc(NC(=O)c2sccc2C)n1 |
| InChI | InChI=1S/C11H11N3O2S2/c1-6-3-4-17-9(6)10(15)13-11-12-8(5-18-11)7(2)14-16/h3-5,16H,1-2H3,(H,12,13,15) |
| InChIKey | QVASMLLFUHSXNO-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 74.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.36 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|