C11H13N5O2S2 — CID 77059521
N-[4-(N-hydroxy-C-methylcarbonimidoyl)-1,3-thiazol-2-yl]-4-propan-2-ylthiadiazole-5-carboxamide (PubChem CID 77059521) has the molecular formula C11H13N5O2S2 and a molecular weight of 311.39 g/mol. Its IUPAC name is N-[4-(N-hydroxy-C-methylcarbonimidoyl)-1,3-thiazol-2-yl]-4-propan-2-ylthiadiazole-5-carboxamide.
| Compound Name | N-[4-(N-hydroxy-C-methylcarbonimidoyl)-1,3-thiazol-2-yl]-4-propan-2-ylthiadiazole-5-carboxamide |
|---|---|
| PubChem CID | 77059521 |
| Molecular Formula | C11H13N5O2S2 |
| Molecular Weight | 311.39 g/mol |
| Exact Mass | 311.05 |
| IUPAC Name | N-[4-(N-hydroxy-C-methylcarbonimidoyl)-1,3-thiazol-2-yl]-4-propan-2-ylthiadiazole-5-carboxamide |
| SMILES | CC(=NO)c1csc(NC(=O)c2snnc2C(C)C)n1 |
| InChI | InChI=1S/C11H13N5O2S2/c1-5(2)8-9(20-16-14-8)10(17)13-11-12-7(4-19-11)6(3)15-18/h4-5,18H,1-3H3,(H,12,13,17) |
| InChIKey | LWRAYXDPWDNUSV-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 100.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.39 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|