C21H21ClIN3O2S — CID 121067415
2-iodo-N-[4-[(6-methoxy-3,4-dihydro-1H-isoquinolin-2-yl)methyl]-1,3-thiazol-2-yl]benzamide;hydrochloride (PubChem CID 121067415) has the molecular formula C21H21ClIN3O2S and a molecular weight of 541.84 g/mol. Its IUPAC name is 2-iodo-N-[4-[(6-methoxy-3,4-dihydro-1H-isoquinolin-2-yl)methyl]-1,3-thiazol-2-yl]benzamide;hydrochloride.
| Compound Name | 2-iodo-N-[4-[(6-methoxy-3,4-dihydro-1H-isoquinolin-2-yl)methyl]-1,3-thiazol-2-yl]benzamide;hydrochloride |
|---|---|
| PubChem CID | 121067415 |
| Molecular Formula | C21H21ClIN3O2S |
| Molecular Weight | 541.84 g/mol |
| Exact Mass | 541.01 |
| IUPAC Name | 2-iodo-N-[4-[(6-methoxy-3,4-dihydro-1H-isoquinolin-2-yl)methyl]-1,3-thiazol-2-yl]benzamide;hydrochloride |
| SMILES | COc1ccc2c(c1)CCN(Cc1csc(NC(=O)c3ccccc3I)n1)C2.Cl |
| InChI | InChI=1S/C21H20IN3O2S.ClH/c1-27-17-7-6-15-11-25(9-8-14(15)10-17)12-16-13-28-21(23-16)24-20(26)18-4-2-3-5-19(18)22;/h2-7,10,13H,8-9,11-12H2,1H3,(H,23,24,26);1H |
| InChIKey | WTENLNJFXDOEMN-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.84 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|