C17H21N3O4S — CID 30547700
2,4-dimethoxy-N-[4-(morpholin-4-ylmethyl)-1,3-thiazol-2-yl]benzamide (PubChem CID 30547700) has the molecular formula C17H21N3O4S and a molecular weight of 363.44 g/mol. Its IUPAC name is 2,4-dimethoxy-N-[4-(morpholin-4-ylmethyl)-1,3-thiazol-2-yl]benzamide.
| Compound Name | 2,4-dimethoxy-N-[4-(morpholin-4-ylmethyl)-1,3-thiazol-2-yl]benzamide |
|---|---|
| PubChem CID | 30547700 |
| Molecular Formula | C17H21N3O4S |
| Molecular Weight | 363.44 g/mol |
| Exact Mass | 363.13 |
| IUPAC Name | 2,4-dimethoxy-N-[4-(morpholin-4-ylmethyl)-1,3-thiazol-2-yl]benzamide |
| SMILES | COc1ccc(C(=O)Nc2nc(CN3CCOCC3)cs2)c(OC)c1 |
| InChI | InChI=1S/C17H21N3O4S/c1-22-13-3-4-14(15(9-13)23-2)16(21)19-17-18-12(11-25-17)10-20-5-7-24-8-6-20/h3-4,9,11H,5-8,10H2,1-2H3,(H,18,19,21) |
| InChIKey | WJFMDOJVUWANIA-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 72.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.44 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |