C22H26N4O3S — CID 167947490
3-(2,5-dimethylpyrrol-1-yl)-4-methoxy-N-[4-(morpholin-4-ylmethyl)-1,3-thiazol-2-yl]benzamide (PubChem CID 167947490) has the molecular formula C22H26N4O3S and a molecular weight of 426.54 g/mol. Its IUPAC name is 3-(2,5-dimethylpyrrol-1-yl)-4-methoxy-N-[4-(morpholin-4-ylmethyl)-1,3-thiazol-2-yl]benzamide.
| Compound Name | 3-(2,5-dimethylpyrrol-1-yl)-4-methoxy-N-[4-(morpholin-4-ylmethyl)-1,3-thiazol-2-yl]benzamide |
|---|---|
| PubChem CID | 167947490 |
| Molecular Formula | C22H26N4O3S |
| Molecular Weight | 426.54 g/mol |
| Exact Mass | 426.17 |
| IUPAC Name | 3-(2,5-dimethylpyrrol-1-yl)-4-methoxy-N-[4-(morpholin-4-ylmethyl)-1,3-thiazol-2-yl]benzamide |
| SMILES | COc1ccc(C(=O)Nc2nc(CN3CCOCC3)cs2)cc1-n1c(C)ccc1C |
| InChI | InChI=1S/C22H26N4O3S/c1-15-4-5-16(2)26(15)19-12-17(6-7-20(19)28-3)21(27)24-22-23-18(14-30-22)13-25-8-10-29-11-9-25/h4-7,12,14H,8-11,13H2,1-3H3,(H,23,24,27) |
| InChIKey | KZZWNTCXTRTCDX-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 68.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.54 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'} |
|---|